C13H12N4O2S — CID 14476428
N-(3,3-dimethyl-2-oxo-1H-indol-6-yl)thiadiazole-4-carboxamide (PubChem CID 14476428) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxo-1H-indol-6-yl)thiadiazole-4-carboxamide.
| Compound Name | N-(3,3-dimethyl-2-oxo-1H-indol-6-yl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 14476428 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(3,3-dimethyl-2-oxo-1H-indol-6-yl)thiadiazole-4-carboxamide |
| SMILES | CC1(C)C(=O)Nc2cc(NC(=O)c3csnn3)ccc21 |
| InChI | InChI=1S/C13H12N4O2S/c1-13(2)8-4-3-7(5-9(8)15-12(13)19)14-11(18)10-6-20-17-16-10/h3-6H,1-2H3,(H,14,18)(H,15,19) |
| InChIKey | RLBRHNMYPPMLNY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |