C17H15ClN2O2 — CID 14856608
N-(3-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide (PubChem CID 14856608) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 14856608 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-(3-chlorophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
| SMILES | CC1(C)C(=O)Nc2cc(C(=O)Nc3cccc(Cl)c3)ccc21 |
| InChI | InChI=1S/C17H15ClN2O2/c1-17(2)13-7-6-10(8-14(13)20-16(17)22)15(21)19-12-5-3-4-11(18)9-12/h3-9H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | JYGWRVMRMPHIQH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |