C17H14Cl2N2O2 — CID 110405719
3,4-dichloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)benzamide (PubChem CID 110405719) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 3,4-dichloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)benzamide.
| Compound Name | 3,4-dichloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)benzamide |
|---|---|
| PubChem CID | 110405719 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3,4-dichloro-N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)benzamide |
| SMILES | CC1(C)C(=O)Nc2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-17(2)11-8-10(4-6-14(11)21-16(17)23)20-15(22)9-3-5-12(18)13(19)7-9/h3-8H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | RTQGOHIUYXHXOU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |