C22H23N5O2 — CID 143951852
N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-4-methyl-3-[1-[(Z)-(methylideneamino)methylideneamino]ethenylamino]benzamide (PubChem CID 143951852) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-4-methyl-3-[1-[(Z)-(methylideneamino)methylideneamino]ethenylamino]benzamide.
| Compound Name | N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-4-methyl-3-[1-[(Z)-(methylideneamino)methylideneamino]ethenylamino]benzamide |
|---|---|
| PubChem CID | 143951852 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-4-methyl-3-[1-[(Z)-(methylideneamino)methylideneamino]ethenylamino]benzamide |
| SMILES | C=N/C=N\C(=C)Nc1cc(C(=O)Nc2ccc3c(c2)C(C)(C)C(=O)N3)ccc1C |
| InChI | InChI=1S/C22H23N5O2/c1-13-6-7-15(10-19(13)25-14(2)24-12-23-5)20(28)26-16-8-9-18-17(11-16)22(3,4)21(29)27-18/h6-12,25H,2,5H2,1,3-4H3,(H,26,28)(H,27,29)/b24-12- |
| InChIKey | FBYFHXNYHIRTBJ-MSXFZWOLSA-N |
| XLogP | 4.09 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|