C20H22N2O2 — CID 75361159
N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-3,4-dimethylbenzamide (PubChem CID 75361159) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-3,4-dimethylbenzamide.
| Compound Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 75361159 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3c(c2)C(C)(C)CC(=O)N3)cc1C |
| InChI | InChI=1S/C20H22N2O2/c1-12-5-6-14(9-13(12)2)19(24)21-15-7-8-17-16(10-15)20(3,4)11-18(23)22-17/h5-10H,11H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | ZZERYEPBEFALJL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |