C19H17N3O2 — CID 18952439
4-cyano-N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide (PubChem CID 18952439) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-cyano-N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide.
| Compound Name | 4-cyano-N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 18952439 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4-cyano-N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)benzamide |
| SMILES | CC1(C)CC(=O)Nc2cc(NC(=O)c3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C19H17N3O2/c1-19(2)10-17(23)22-16-9-14(7-8-15(16)19)21-18(24)13-5-3-12(11-20)4-6-13/h3-9H,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | HNBNUBNRPMORGN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |