C21H22N2O3 — CID 18952446
N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-3-prop-2-enoxybenzamide (PubChem CID 18952446) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-3-prop-2-enoxybenzamide.
| Compound Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-3-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 18952446 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-3-prop-2-enoxybenzamide |
| SMILES | C=CCOc1cccc(C(=O)Nc2ccc3c(c2)NC(=O)CC3(C)C)c1 |
| InChI | InChI=1S/C21H22N2O3/c1-4-10-26-16-7-5-6-14(11-16)20(25)22-15-8-9-17-18(12-15)23-19(24)13-21(17,2)3/h4-9,11-12H,1,10,13H2,2-3H3,(H,22,25)(H,23,24) |
| InChIKey | LFIQROJAJXJPGV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|