C43H54N4O2 — CID 143210981
N-(4,4-dimethyl-2,3-dihydro-1H-quinolin-7-yl)-3,4-dimethylbenzamide;7-[1-(3,4-dimethylphenyl)ethenylamino]-4,4-dimethyl-1,3-dihydroquinolin-2-one;ethane (PubChem CID 143210981) has the molecular formula C43H54N4O2 and a molecular weight of 658.93 g/mol. Its IUPAC name is N-(4,4-dimethyl-2,3-dihydro-1H-quinolin-7-yl)-3,4-dimethylbenzamide;7-[1-(3,4-dimethylphenyl)ethenylamino]-4,4-dimethyl-1,3-dihydroquinolin-2-one;ethane.
| Compound Name | N-(4,4-dimethyl-2,3-dihydro-1H-quinolin-7-yl)-3,4-dimethylbenzamide;7-[1-(3,4-dimethylphenyl)ethenylamino]-4,4-dimethyl-1,3-dihydroquinolin-2-one;ethane |
|---|---|
| PubChem CID | 143210981 |
| Molecular Formula | C43H54N4O2 |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | N-(4,4-dimethyl-2,3-dihydro-1H-quinolin-7-yl)-3,4-dimethylbenzamide;7-[1-(3,4-dimethylphenyl)ethenylamino]-4,4-dimethyl-1,3-dihydroquinolin-2-one;ethane |
| SMILES | C=C(Nc1ccc2c(c1)NC(=O)CC2(C)C)c1ccc(C)c(C)c1.CC.Cc1ccc(C(=O)Nc2ccc3c(c2)NCCC3(C)C)cc1C |
| InChI | InChI=1S/C21H24N2O.C20H24N2O.C2H6/c1-13-6-7-16(10-14(13)2)15(3)22-17-8-9-18-19(11-17)23-20(24)12-21(18,4)5;1-13-5-6-15(11-14(13)2)19(23)22-16-7-8-17-18(12-16)21-10-9-20(17,3)4;1-2/h6-11,22H,3,12H2,1-2,4-5H3,(H,23,24);5-8,11-12,21H,9-10H2,1-4H3,(H,22,23);1-2H3 |
| InChIKey | JZAOASPSLLLLNE-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |