C18H18N2O4S — CID 110619936
N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylsulfonylbenzamide (PubChem CID 110619936) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 110619936 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylsulfonylbenzamide |
| SMILES | CC1(C)C(=O)Nc2ccc(NC(=O)c3cccc(S(C)(=O)=O)c3)cc21 |
| InChI | InChI=1S/C18H18N2O4S/c1-18(2)14-10-12(7-8-15(14)20-17(18)22)19-16(21)11-5-4-6-13(9-11)25(3,23)24/h4-10H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | OIBFZTIYCQRTFA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |