C18H13ClN2O3 — CID 87468392
7-N-(3-chlorophenyl)-2-N-hydroxynaphthalene-2,7-dicarboxamide (PubChem CID 87468392) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is 7-N-(3-chlorophenyl)-2-N-hydroxynaphthalene-2,7-dicarboxamide.
| Compound Name | 7-N-(3-chlorophenyl)-2-N-hydroxynaphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 87468392 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 7-N-(3-chlorophenyl)-2-N-hydroxynaphthalene-2,7-dicarboxamide |
| SMILES | O=C(NO)c1ccc2ccc(C(=O)Nc3cccc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C18H13ClN2O3/c19-15-2-1-3-16(10-15)20-17(22)12-6-4-11-5-7-13(18(23)21-24)9-14(11)8-12/h1-10,24H,(H,20,22)(H,21,23) |
| InChIKey | VEAOFQSUBYHMMW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|