C17H17N3O2 — CID 165032676
1-(2-methoxyphenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea (PubChem CID 165032676) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(2-methoxyphenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 165032676 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea |
| SMILES | C=C1Cc2cc(NC(=O)Nc3ccccc3OC)ccc2N1 |
| InChI | InChI=1S/C17H17N3O2/c1-11-9-12-10-13(7-8-14(12)18-11)19-17(21)20-15-5-3-4-6-16(15)22-2/h3-8,10,18H,1,9H2,2H3,(H2,19,20,21) |
| InChIKey | IJANCQDDIBYLGY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |