C16H14FN3O — CID 164953050
1-(4-fluorophenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea (PubChem CID 164953050) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 164953050 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-methylidene-1,3-dihydroindol-5-yl)urea |
| SMILES | C=C1Cc2cc(NC(=O)Nc3ccc(F)cc3)ccc2N1 |
| InChI | InChI=1S/C16H14FN3O/c1-10-8-11-9-14(6-7-15(11)18-10)20-16(21)19-13-4-2-12(17)3-5-13/h2-7,9,18H,1,8H2,(H2,19,20,21) |
| InChIKey | OAJVJHFXFNNJIE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |