C17H16FN3O2 — CID 30376046
1-(4-fluorophenyl)-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea (PubChem CID 30376046) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea |
|---|---|
| PubChem CID | 30376046 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea |
| SMILES | CN1C(=O)CCc2cc(NC(=O)Nc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C17H16FN3O2/c1-21-15-8-7-14(10-11(15)2-9-16(21)22)20-17(23)19-13-5-3-12(18)4-6-13/h3-8,10H,2,9H2,1H3,(H2,19,20,23) |
| InChIKey | WVQVWMWIQOCBQA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |