C24H23N3O2 — CID 30376078
1-benzhydryl-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea (PubChem CID 30376078) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-benzhydryl-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea.
| Compound Name | 1-benzhydryl-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea |
|---|---|
| PubChem CID | 30376078 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-benzhydryl-3-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)urea |
| SMILES | CN1C(=O)CCc2cc(NC(=O)NC(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C24H23N3O2/c1-27-21-14-13-20(16-19(21)12-15-22(27)28)25-24(29)26-23(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,13-14,16,23H,12,15H2,1H3,(H2,25,26,29) |
| InChIKey | NGRRMTQMZZBZQB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |