C14H12N2O4 — CID 102710831
2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]pent-4-ynoic acid (PubChem CID 102710831) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]pent-4-ynoic acid.
| Compound Name | 2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 102710831 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)c1ccc2c(c1)CC(=O)N2)C(=O)O |
| InChI | InChI=1S/C14H12N2O4/c1-2-3-11(14(19)20)16-13(18)8-4-5-10-9(6-8)7-12(17)15-10/h1,4-6,11H,3,7H2,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | MAKQYNPXQOURFI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|