C22H20N2O2 — CID 86911762
N-(1-naphthalen-1-ylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 86911762) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-(1-naphthalen-1-ylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 86911762 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)CCC(=O)N2)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H20N2O2/c1-14(18-8-4-6-15-5-2-3-7-19(15)18)23-22(26)17-9-11-20-16(13-17)10-12-21(25)24-20/h2-9,11,13-14H,10,12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | UHKMCMNFFYIKLY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |