C23H26N2O2 — CID 86899515
N-(1-cyclopentyl-2-phenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 86899515) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-(1-cyclopentyl-2-phenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-(1-cyclopentyl-2-phenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 86899515 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-(1-cyclopentyl-2-phenylethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | O=C1CCc2cc(C(=O)NC(Cc3ccccc3)C3CCCC3)ccc2N1 |
| InChI | InChI=1S/C23H26N2O2/c26-22-13-11-18-15-19(10-12-20(18)24-22)23(27)25-21(17-8-4-5-9-17)14-16-6-2-1-3-7-16/h1-3,6-7,10,12,15,17,21H,4-5,8-9,11,13-14H2,(H,24,26)(H,25,27) |
| InChIKey | PVSFIRUJBWAJMW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |