C24H28N2O2 — CID 21465114
7-[2-(4-benzylpiperidin-1-yl)acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 21465114) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 7-[2-(4-benzylpiperidin-1-yl)acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[2-(4-benzylpiperidin-1-yl)acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 21465114 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 7-[2-(4-benzylpiperidin-1-yl)acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(C(=O)CN3CCC(Cc4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C24H28N2O2/c27-23(21-9-10-22-20(16-21)7-4-8-24(28)25-22)17-26-13-11-19(12-14-26)15-18-5-2-1-3-6-18/h1-3,5-6,9-10,16,19H,4,7-8,11-15,17H2,(H,25,28) |
| InChIKey | SPSXFNLPSXGSGC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |