C19H28N3O2S+ — CID 3504225
N-[3-(2-ethylpiperidin-1-ium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 3504225) has the molecular formula C19H28N3O2S+ and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-ium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-ium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 3504225 |
| Molecular Formula | C19H28N3O2S+ |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-ium-1-yl)propyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCC1CCCC[NH+]1CCCNC(=O)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C19H27N3O2S/c1-2-15-6-3-4-10-22(15)11-5-9-20-19(24)14-7-8-17-16(12-14)21-18(23)13-25-17/h7-8,12,15H,2-6,9-11,13H2,1H3,(H,20,24)(H,21,23)/p+1 |
| InChIKey | HRBDRHBFACFPPP-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|