About 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one
7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one (PubChem CID 138712725) has the molecular formula C11H7IN2OS
and a molecular weight of 342.16 g/mol. Its IUPAC name is 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one.
Molecular Properties
| Compound Name | 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one |
| PubChem CID | 138712725 |
| Molecular Formula | C11H7IN2OS |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one |
| SMILES | O=C1CSc2cc3ccc(I)cc3nc2N1 |
| InChI | InChI=1S/C11H7IN2OS/c12-7-2-1-6-3-9-11(13-8(6)4-7)14-10(15)5-16-9/h1-4H,5H2,(H,13,14,15) |
| InChIKey | DNEJHRWZIIPIBP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one?
The IUPAC name of 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one (CID 138712725) is 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one.
What is the SMILES notation for 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one?
The canonical SMILES for 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one is O=C1CSc2cc3ccc(I)cc3nc2N1.
What is the InChIKey of 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one?
The InChIKey is DNEJHRWZIIPIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7IN2OS/c12-7-2-1-6-3-9-11(13-8(6)4-7)14-10(15)5-16-9/h1-4H,5H2,(H,13,14,15).
What are the key properties of 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one?
7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one has a molecular weight of 342.16 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-4H-[1,4]thiazino[3,2-b]quinolin-3-one is sourced from PubChem (CID 138712725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).