C7H5IN2OS — CID 170247234
7-iodo-1H-pyrido[2,3-b][1,4]thiazin-2-one (PubChem CID 170247234) has the molecular formula C7H5IN2OS and a molecular weight of 292.10 g/mol. Its IUPAC name is 7-iodo-1H-pyrido[2,3-b][1,4]thiazin-2-one.
| Compound Name | 7-iodo-1H-pyrido[2,3-b][1,4]thiazin-2-one |
|---|---|
| PubChem CID | 170247234 |
| Molecular Formula | C7H5IN2OS |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 291.92 |
| IUPAC Name | 7-iodo-1H-pyrido[2,3-b][1,4]thiazin-2-one |
| SMILES | O=C1CSc2ncc(I)cc2N1 |
| InChI | InChI=1S/C7H5IN2OS/c8-4-1-5-7(9-2-4)12-3-6(11)10-5/h1-2H,3H2,(H,10,11) |
| InChIKey | VOKPJYFYCSKCKL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|