C6H6N4OS — CID 165475166
3-amino-5H-pyridazino[3,4-b][1,4]thiazin-6-one (PubChem CID 165475166) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is 3-amino-5H-pyridazino[3,4-b][1,4]thiazin-6-one.
| Compound Name | 3-amino-5H-pyridazino[3,4-b][1,4]thiazin-6-one |
|---|---|
| PubChem CID | 165475166 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 3-amino-5H-pyridazino[3,4-b][1,4]thiazin-6-one |
| SMILES | Nc1cc2c(nn1)SCC(=O)N2 |
| InChI | InChI=1S/C6H6N4OS/c7-4-1-3-6(10-9-4)12-2-5(11)8-3/h1H,2H2,(H2,7,9)(H,8,11) |
| InChIKey | UQECNTCPPMUAKS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |