C11H9N3OS2 — CID 82486044
6-(5-amino-1,3-thiazol-4-yl)-4H-1,4-benzothiazin-3-one (PubChem CID 82486044) has the molecular formula C11H9N3OS2 and a molecular weight of 263.35 g/mol. Its IUPAC name is 6-(5-amino-1,3-thiazol-4-yl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(5-amino-1,3-thiazol-4-yl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 82486044 |
| Molecular Formula | C11H9N3OS2 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 6-(5-amino-1,3-thiazol-4-yl)-4H-1,4-benzothiazin-3-one |
| SMILES | Nc1scnc1-c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H9N3OS2/c12-11-10(13-5-17-11)6-1-2-8-7(3-6)14-9(15)4-16-8/h1-3,5H,4,12H2,(H,14,15) |
| InChIKey | KPQRXPZRIBSAAK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |