C13H13N3OS — CID 116856790
6-(2,5-dimethylpyrazol-3-yl)-4H-1,4-benzothiazin-3-one (PubChem CID 116856790) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 6-(2,5-dimethylpyrazol-3-yl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(2,5-dimethylpyrazol-3-yl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116856790 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 6-(2,5-dimethylpyrazol-3-yl)-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cc(-c2ccc3c(c2)NC(=O)CS3)n(C)n1 |
| InChI | InChI=1S/C13H13N3OS/c1-8-5-11(16(2)15-8)9-3-4-12-10(6-9)14-13(17)7-18-12/h3-6H,7H2,1-2H3,(H,14,17) |
| InChIKey | WCOYJKUZDZUWSY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |