C9H10N2OS — CID 89066606
7-ethyl-1H-pyrido[2,3-b][1,4]thiazin-2-one (PubChem CID 89066606) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 7-ethyl-1H-pyrido[2,3-b][1,4]thiazin-2-one.
| Compound Name | 7-ethyl-1H-pyrido[2,3-b][1,4]thiazin-2-one |
|---|---|
| PubChem CID | 89066606 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 7-ethyl-1H-pyrido[2,3-b][1,4]thiazin-2-one |
| SMILES | CCc1cnc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C9H10N2OS/c1-2-6-3-7-9(10-4-6)13-5-8(12)11-7/h3-4H,2,5H2,1H3,(H,11,12) |
| InChIKey | VWJINDLNAALYFE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |