C7H7N3O2S — CID 126613471
6-(hydroxymethyl)-4H-pyrazino[2,3-b][1,4]thiazin-3-one (PubChem CID 126613471) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is 6-(hydroxymethyl)-4H-pyrazino[2,3-b][1,4]thiazin-3-one.
| Compound Name | 6-(hydroxymethyl)-4H-pyrazino[2,3-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 126613471 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 6-(hydroxymethyl)-4H-pyrazino[2,3-b][1,4]thiazin-3-one |
| SMILES | O=C1CSc2ncc(CO)nc2N1 |
| InChI | InChI=1S/C7H7N3O2S/c11-2-4-1-8-7-6(9-4)10-5(12)3-13-7/h1,11H,2-3H2,(H,9,10,12) |
| InChIKey | OSQKCEWPZKAWEC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |