C11H11N7O2S — CID 155662434
6-[(3R)-5-(azidomethyl)-2-oxopyrrolidin-3-yl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one (PubChem CID 155662434) has the molecular formula C11H11N7O2S and a molecular weight of 305.32 g/mol. Its IUPAC name is 6-[(3R)-5-(azidomethyl)-2-oxopyrrolidin-3-yl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one.
| Compound Name | 6-[(3R)-5-(azidomethyl)-2-oxopyrrolidin-3-yl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 155662434 |
| Molecular Formula | C11H11N7O2S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 6-[(3R)-5-(azidomethyl)-2-oxopyrrolidin-3-yl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one |
| SMILES | [N-]=[N+]=NCC1C[C@H](c2cnc3c(n2)NC(=O)CS3)C(=O)N1 |
| InChI | InChI=1S/C11H11N7O2S/c12-18-14-2-5-1-6(10(20)15-5)7-3-13-11-9(16-7)17-8(19)4-21-11/h3,5-6H,1-2,4H2,(H,15,20)(H,16,17,19)/t5?,6-/m1/s1 |
| InChIKey | RVPZAZRAJPDFNR-PRJDIBJQSA-N |
| XLogP | 0.80 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|