C23H25FN8O2S — CID 137441910
6-[[[4-[[3-fluoro-6-[(E)-hydroxyiminomethyl]-1,5-naphthyridin-4-yl]methylamino]cyclohexyl]amino]methyl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one (PubChem CID 137441910) has the molecular formula C23H25FN8O2S and a molecular weight of 496.57 g/mol. Its IUPAC name is 6-[[[4-[[3-fluoro-6-[(E)-hydroxyiminomethyl]-1,5-naphthyridin-4-yl]methylamino]cyclohexyl]amino]methyl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one.
| Compound Name | 6-[[[4-[[3-fluoro-6-[(E)-hydroxyiminomethyl]-1,5-naphthyridin-4-yl]methylamino]cyclohexyl]amino]methyl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 137441910 |
| Molecular Formula | C23H25FN8O2S |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 6-[[[4-[[3-fluoro-6-[(E)-hydroxyiminomethyl]-1,5-naphthyridin-4-yl]methylamino]cyclohexyl]amino]methyl]-4H-pyrazino[2,3-b][1,4]thiazin-3-one |
| SMILES | O=C1CSc2ncc(CNC3CCC(NCc4c(F)cnc5ccc(/C=N/O)nc45)CC3)nc2N1 |
| InChI | InChI=1S/C23H25FN8O2S/c24-18-11-27-19-6-5-15(9-29-34)30-21(19)17(18)10-26-14-3-1-13(2-4-14)25-7-16-8-28-23-22(31-16)32-20(33)12-35-23/h5-6,8-9,11,13-14,25-26,34H,1-4,7,10,12H2,(H,31,32,33)/b29-9+ |
| InChIKey | IIDJNPCTPWCRQA-GESPGMLMSA-N |
| XLogP | 2.60 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|