C11H11N3O4S — CID 135236065
(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methyl N-(2-oxoethyl)carbamate (PubChem CID 135236065) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is (3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methyl N-(2-oxoethyl)carbamate.
| Compound Name | (3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methyl N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 135236065 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methyl N-(2-oxoethyl)carbamate |
| SMILES | O=CCNC(=O)OCc1ccc2c(n1)NC(=O)CS2 |
| InChI | InChI=1S/C11H11N3O4S/c15-4-3-12-11(17)18-5-7-1-2-8-10(13-7)14-9(16)6-19-8/h1-2,4H,3,5-6H2,(H,12,17)(H,13,14,16) |
| InChIKey | DUMQNZDIRINVNY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|