C9H9FN2OS — CID 142269843
6-ethyl-7-fluoro-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 142269843) has the molecular formula C9H9FN2OS and a molecular weight of 212.25 g/mol. Its IUPAC name is 6-ethyl-7-fluoro-4H-pyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-ethyl-7-fluoro-4H-pyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 142269843 |
| Molecular Formula | C9H9FN2OS |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 6-ethyl-7-fluoro-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | CCc1nc2c(cc1F)SCC(=O)N2 |
| InChI | InChI=1S/C9H9FN2OS/c1-2-6-5(10)3-7-9(11-6)12-8(13)4-14-7/h3H,2,4H2,1H3,(H,11,12,13) |
| InChIKey | LEPUEPBBBUUNFQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |