C16H21N3O2S — CID 110776133
1-cyclopentyl-3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]urea (PubChem CID 110776133) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]urea |
|---|---|
| PubChem CID | 110776133 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-cyclopentyl-3-[2-(3-oxo-4H-1,4-benzothiazin-6-yl)ethyl]urea |
| SMILES | O=C1CSc2ccc(CCNC(=O)NC3CCCC3)cc2N1 |
| InChI | InChI=1S/C16H21N3O2S/c20-15-10-22-14-6-5-11(9-13(14)19-15)7-8-17-16(21)18-12-3-1-2-4-12/h5-6,9,12H,1-4,7-8,10H2,(H,19,20)(H2,17,18,21) |
| InChIKey | AWHVAOQOLVAPFQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |