C13H19NS2 — CID 115224925
3-(3,4-dihydro-2H-thiochromen-6-ylmethylamino)propane-1-thiol (PubChem CID 115224925) has the molecular formula C13H19NS2 and a molecular weight of 253.44 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-thiochromen-6-ylmethylamino)propane-1-thiol.
| Compound Name | 3-(3,4-dihydro-2H-thiochromen-6-ylmethylamino)propane-1-thiol |
|---|---|
| PubChem CID | 115224925 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-(3,4-dihydro-2H-thiochromen-6-ylmethylamino)propane-1-thiol |
| SMILES | SCCCNCc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C13H19NS2/c15-7-2-6-14-10-11-4-5-13-12(9-11)3-1-8-16-13/h4-5,9,14-15H,1-3,6-8,10H2 |
| InChIKey | VYHOYZLXCYHPLL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|