C12H17NS — CID 168764165
2-(2,3-dihydro-1-benzothiophen-5-yl)-N-ethylethanamine (PubChem CID 168764165) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-5-yl)-N-ethylethanamine.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-5-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 168764165 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-5-yl)-N-ethylethanamine |
| SMILES | CCNCCc1ccc2c(c1)CCS2 |
| InChI | InChI=1S/C12H17NS/c1-2-13-7-5-10-3-4-12-11(9-10)6-8-14-12/h3-4,9,13H,2,5-8H2,1H3 |
| InChIKey | CETXTIWUYGOQFG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|