C13H20N2 — CID 115104816
N-ethyl-2-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanamine (PubChem CID 115104816) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-ethyl-2-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanamine.
| Compound Name | N-ethyl-2-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanamine |
|---|---|
| PubChem CID | 115104816 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-ethyl-2-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanamine |
| SMILES | CCNCCc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C13H20N2/c1-2-14-7-5-11-3-4-13-10-15-8-6-12(13)9-11/h3-4,9,14-15H,2,5-8,10H2,1H3 |
| InChIKey | HAJZHZTVSNFGNF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|