C13H20N2 — CID 115105185
N-[2-(2,3-dihydro-1H-isoindol-5-yl)ethyl]propan-2-amine (PubChem CID 115105185) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-isoindol-5-yl)ethyl]propan-2-amine.
| Compound Name | N-[2-(2,3-dihydro-1H-isoindol-5-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 115105185 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-isoindol-5-yl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCc1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C13H20N2/c1-10(2)15-6-5-11-3-4-12-8-14-9-13(12)7-11/h3-4,7,10,14-15H,5-6,8-9H2,1-2H3 |
| InChIKey | OEFNLRVULLFKGO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |