C12H18N2 — CID 83963309
N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)ethanamine (PubChem CID 83963309) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)ethanamine.
| Compound Name | N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 83963309 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)ethanamine |
| SMILES | CCNCc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C12H18N2/c1-2-13-8-10-3-4-12-9-14-6-5-11(12)7-10/h3-4,7,13-14H,2,5-6,8-9H2,1H3 |
| InChIKey | LCJAXCJUKLYXCP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |