C21H33ClN2O — CID 164904797
(1R,2S,5R)-5-methyl-2-propan-2-yl-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 164904797) has the molecular formula C21H33ClN2O and a molecular weight of 364.96 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-2-propan-2-yl-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | (1R,2S,5R)-5-methyl-2-propan-2-yl-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 164904797 |
| Molecular Formula | C21H33ClN2O |
| Molecular Weight | 364.96 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (1R,2S,5R)-5-methyl-2-propan-2-yl-N-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)NCc1ccc2c(c1)CCNC2.Cl |
| InChI | InChI=1S/C21H32N2O.ClH/c1-14(2)19-7-4-15(3)10-20(19)21(24)23-12-16-5-6-18-13-22-9-8-17(18)11-16;/h5-6,11,14-15,19-20,22H,4,7-10,12-13H2,1-3H3,(H,23,24);1H/t15-,19+,20-;/m1./s1 |
| InChIKey | YTFUXVXIUIPZSF-JEWXFCQKSA-N |
| XLogP | 4.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |