C12H16ClFN2 — CID 115207813
N-(azetidin-3-ylmethyl)-2-(3-chloro-4-fluorophenyl)ethanamine (PubChem CID 115207813) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-2-(3-chloro-4-fluorophenyl)ethanamine.
| Compound Name | N-(azetidin-3-ylmethyl)-2-(3-chloro-4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 115207813 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-2-(3-chloro-4-fluorophenyl)ethanamine |
| SMILES | Fc1ccc(CCNCC2CNC2)cc1Cl |
| InChI | InChI=1S/C12H16ClFN2/c13-11-5-9(1-2-12(11)14)3-4-15-6-10-7-16-8-10/h1-2,5,10,15-16H,3-4,6-8H2 |
| InChIKey | VNBOGFPEFHECEL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|