C12H18ClFN2 — CID 115201435
N'-[2-(3-chloro-4-fluorophenyl)ethyl]butane-1,4-diamine (PubChem CID 115201435) has the molecular formula C12H18ClFN2 and a molecular weight of 244.74 g/mol. Its IUPAC name is N'-[2-(3-chloro-4-fluorophenyl)ethyl]butane-1,4-diamine.
| Compound Name | N'-[2-(3-chloro-4-fluorophenyl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 115201435 |
| Molecular Formula | C12H18ClFN2 |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N'-[2-(3-chloro-4-fluorophenyl)ethyl]butane-1,4-diamine |
| SMILES | NCCCCNCCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClFN2/c13-11-9-10(3-4-12(11)14)5-8-16-7-2-1-6-15/h3-4,9,16H,1-2,5-8,15H2 |
| InChIKey | HARQEJKOOSCMIV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|