C13H20ClFN2 — CID 115202766
N-[2-(3-chloro-4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine (PubChem CID 115202766) has the molecular formula C13H20ClFN2 and a molecular weight of 258.77 g/mol. Its IUPAC name is N-[2-(3-chloro-4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine.
| Compound Name | N-[2-(3-chloro-4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115202766 |
| Molecular Formula | C13H20ClFN2 |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | N-[2-(3-chloro-4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine |
| SMILES | CC(CCN)CNCCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClFN2/c1-10(4-6-16)9-17-7-5-11-2-3-13(15)12(14)8-11/h2-3,8,10,17H,4-7,9,16H2,1H3 |
| InChIKey | HPVURXVTAAYIMW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|