C13H21FN2 — CID 115202719
N-[2-(4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine (PubChem CID 115202719) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115202719 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-methylbutane-1,4-diamine |
| SMILES | CC(CCN)CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C13H21FN2/c1-11(6-8-15)10-16-9-7-12-2-4-13(14)5-3-12/h2-5,11,16H,6-10,15H2,1H3 |
| InChIKey | OIEGKBBOWCDADD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|