C14H22FNO2 — CID 60632265
1-[2-(4-fluorophenyl)ethylamino]-3-propan-2-yloxypropan-2-ol (PubChem CID 60632265) has the molecular formula C14H22FNO2 and a molecular weight of 255.33 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethylamino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[2-(4-fluorophenyl)ethylamino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 60632265 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethylamino]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FNO2/c1-11(2)18-10-14(17)9-16-8-7-12-3-5-13(15)6-4-12/h3-6,11,14,16-17H,7-10H2,1-2H3 |
| InChIKey | PBDAOWQXSFIOCJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|