C24H36Br2Cl2N2 — CID 3029595
N,N'-bis[2-(4-chlorophenyl)ethyl]octane-1,8-diamine;dihydrobromide (PubChem CID 3029595) has the molecular formula C24H36Br2Cl2N2 and a molecular weight of 583.28 g/mol. Its IUPAC name is N,N'-bis[2-(4-chlorophenyl)ethyl]octane-1,8-diamine;dihydrobromide.
| Compound Name | N,N'-bis[2-(4-chlorophenyl)ethyl]octane-1,8-diamine;dihydrobromide |
|---|---|
| PubChem CID | 3029595 |
| Molecular Formula | C24H36Br2Cl2N2 |
| Molecular Weight | 583.28 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | N,N'-bis[2-(4-chlorophenyl)ethyl]octane-1,8-diamine;dihydrobromide |
| SMILES | Br.Br.Clc1ccc(CCNCCCCCCCCNCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H34Cl2N2.2BrH/c25-23-11-7-21(8-12-23)15-19-27-17-5-3-1-2-4-6-18-28-20-16-22-9-13-24(26)14-10-22;;/h7-14,27-28H,1-6,15-20H2;2*1H |
| InChIKey | HOPKYYZNNNFJSL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.28 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|