C22H32Br2Cl2N2 — CID 3028564
N,N'-bis[2-(4-chlorophenyl)ethyl]hexane-1,6-diamine;dihydrobromide (PubChem CID 3028564) has the molecular formula C22H32Br2Cl2N2 and a molecular weight of 555.23 g/mol. Its IUPAC name is N,N'-bis[2-(4-chlorophenyl)ethyl]hexane-1,6-diamine;dihydrobromide.
| Compound Name | N,N'-bis[2-(4-chlorophenyl)ethyl]hexane-1,6-diamine;dihydrobromide |
|---|---|
| PubChem CID | 3028564 |
| Molecular Formula | C22H32Br2Cl2N2 |
| Molecular Weight | 555.23 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | N,N'-bis[2-(4-chlorophenyl)ethyl]hexane-1,6-diamine;dihydrobromide |
| SMILES | Br.Br.Clc1ccc(CCNCCCCCCNCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H30Cl2N2.2BrH/c23-21-9-5-19(6-10-21)13-17-25-15-3-1-2-4-16-26-18-14-20-7-11-22(24)12-8-20;;/h5-12,25-26H,1-4,13-18H2;2*1H |
| InChIKey | FFWCMSNVPJQGHN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.23 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|