C13H18N2O4 — CID 115122348
6-[2-(2,3-dihydroxypropylamino)ethyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 115122348) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-[2-(2,3-dihydroxypropylamino)ethyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(2,3-dihydroxypropylamino)ethyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115122348 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-[2-(2,3-dihydroxypropylamino)ethyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(CCNCC(O)CO)ccc21 |
| InChI | InChI=1S/C13H18N2O4/c1-15-11-3-2-9(6-12(11)19-13(15)18)4-5-14-7-10(17)8-16/h2-3,6,10,14,16-17H,4-5,7-8H2,1H3 |
| InChIKey | WHOMNHAIYFXNNY-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|