C14H24BrNO2 — CID 71379239
4-[4-(tert-butylamino)butyl]benzene-1,2-diol;hydrobromide (PubChem CID 71379239) has the molecular formula C14H24BrNO2 and a molecular weight of 318.25 g/mol. Its IUPAC name is 4-[4-(tert-butylamino)butyl]benzene-1,2-diol;hydrobromide.
| Compound Name | 4-[4-(tert-butylamino)butyl]benzene-1,2-diol;hydrobromide |
|---|---|
| PubChem CID | 71379239 |
| Molecular Formula | C14H24BrNO2 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[4-(tert-butylamino)butyl]benzene-1,2-diol;hydrobromide |
| SMILES | Br.CC(C)(C)NCCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H23NO2.BrH/c1-14(2,3)15-9-5-4-6-11-7-8-12(16)13(17)10-11;/h7-8,10,15-17H,4-6,9H2,1-3H3;1H |
| InChIKey | HHWCJIWSCDJCJG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|