C17H16N2O6S — CID 6724715
(2S)-N-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-2-[(2-oxo-2-thiophen-2-ylacetyl)amino]propanamide (PubChem CID 6724715) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-2-[(2-oxo-2-thiophen-2-ylacetyl)amino]propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-2-[(2-oxo-2-thiophen-2-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 6724715 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-ylmethyl)-3-hydroxy-2-[(2-oxo-2-thiophen-2-ylacetyl)amino]propanamide |
| SMILES | O=C(N[C@@H](CO)C(=O)NCc1ccc2c(c1)OCO2)C(=O)c1cccs1 |
| InChI | InChI=1S/C17H16N2O6S/c20-8-11(19-17(23)15(21)14-2-1-5-26-14)16(22)18-7-10-3-4-12-13(6-10)25-9-24-12/h1-6,11,20H,7-9H2,(H,18,22)(H,19,23)/t11-/m0/s1 |
| InChIKey | PLRYYJGDSUCESC-NSHDSACASA-N |
| XLogP | 0.45 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|