C15H26Cl4N2O — CID 17159636
N-[(3,5-dichloro-4-ethoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride (PubChem CID 17159636) has the molecular formula C15H26Cl4N2O and a molecular weight of 392.20 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-ethoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride.
| Compound Name | N-[(3,5-dichloro-4-ethoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17159636 |
| Molecular Formula | C15H26Cl4N2O |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[(3,5-dichloro-4-ethoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine;dihydrochloride |
| SMILES | CCOc1c(Cl)cc(CNCCN(CC)CC)cc1Cl.Cl.Cl |
| InChI | InChI=1S/C15H24Cl2N2O.2ClH/c1-4-19(5-2)8-7-18-11-12-9-13(16)15(20-6-3)14(17)10-12;;/h9-10,18H,4-8,11H2,1-3H3;2*1H |
| InChIKey | AGWLNHRUUPVKAR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|