C16H17BrO3 — CID 83134055
1-bromo-4-[(3,4-dimethoxyphenyl)methoxy]-2-methylbenzene (PubChem CID 83134055) has the molecular formula C16H17BrO3 and a molecular weight of 337.21 g/mol. Its IUPAC name is 1-bromo-4-[(3,4-dimethoxyphenyl)methoxy]-2-methylbenzene.
| Compound Name | 1-bromo-4-[(3,4-dimethoxyphenyl)methoxy]-2-methylbenzene |
|---|---|
| PubChem CID | 83134055 |
| Molecular Formula | C16H17BrO3 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-bromo-4-[(3,4-dimethoxyphenyl)methoxy]-2-methylbenzene |
| SMILES | COc1ccc(COc2ccc(Br)c(C)c2)cc1OC |
| InChI | InChI=1S/C16H17BrO3/c1-11-8-13(5-6-14(11)17)20-10-12-4-7-15(18-2)16(9-12)19-3/h4-9H,10H2,1-3H3 |
| InChIKey | AKDYYCDGFMSDMJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |