C44H65NO12 — CID 101380385
N-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide (PubChem CID 101380385) has the molecular formula C44H65NO12 and a molecular weight of 800.00 g/mol. Its IUPAC name is N-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide.
| Compound Name | N-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide |
|---|---|
| PubChem CID | 101380385 |
| Molecular Formula | C44H65NO12 |
| Molecular Weight | 800.00 g/mol |
| Exact Mass | 799.45 |
| IUPAC Name | N-[2-[2-[2-[2,5-bis(4-hexoxyphenyl)phenoxy]ethoxy]ethoxy]ethoxy]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(OCCCCCC)cc3)c(OCCOCCOCCON(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(C)=O)c2)cc1 |
| InChI | InChI=1S/C44H65NO12/c1-4-6-8-10-22-54-37-17-12-34(13-18-37)36-16-21-39(35-14-19-38(20-15-35)55-23-11-9-7-5-2)42(30-36)56-28-26-52-24-25-53-27-29-57-45(33(3)47)31-40(48)43(50)44(51)41(49)32-46/h12-21,30,40-41,43-44,46,48-51H,4-11,22-29,31-32H2,1-3H3/t40-,41+,43+,44+/m0/s1 |
| InChIKey | CAHBLZIEQZTGDE-UADWQJJCSA-N |
| XLogP | 5.57 |
| TPSA | 176.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.00 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|